C57H53BN12O15 — CID 175628066
CID 175628066 (PubChem CID 175628066) has the molecular formula C57H53BN12O15 and a molecular weight of 1156.93 g/mol.
| Compound Name | CID 175628066 |
|---|---|
| PubChem CID | 175628066 |
| Molecular Formula | C57H53BN12O15 |
| Molecular Weight | 1156.93 g/mol |
| Exact Mass | 1156.38 |
| IUPAC Name | — |
| SMILES | [B][C@@H]1[C@@H](OCc2cn(CCOCCn3cc(CO[C@H]4O[C@H](CN=[N+]=[N-])[C@@H](OC(=O)c5ccccc5)[C@H](OC(=O)c5ccccc5)[C@@H]4OC(=O)c4ccccc4)nn3)nn2)O[C@H](CN=[N+]=[N-])[C@@H](OC(=O)c2ccccc2)[C@@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C57H53BN12O15/c58-45-48(83-53(73)38-20-10-3-11-21-38)46(81-51(71)36-16-6-1-7-17-36)43(30-61-65-59)79-56(45)77-34-41-32-69(67-63-41)26-28-76-29-27-70-33-42(64-68-70)35-78-57-50(85-55(75)40-24-14-5-15-25-40)49(84-54(74)39-22-12-4-13-23-39)47(44(80-57)31-62-66-60)82-52(72)37-18-8-2-9-19-37/h1-25,32-33,43-50,56-57H,26-31,34-35H2/t43-,44-,45+,46-,47-,48-,49+,50+,56+,57+/m1/s1 |
| InChIKey | JXABSNLYVMUPJR-JKLWNEQJSA-N |
| XLogP | 6.78 |
| TPSA | 336.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 23 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 85 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1156.93 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 23 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|