C21H37N3O10 — CID 155602445
(2R,4S,5S)-2-[(Z)-4-[[1-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethyl]triazol-4-yl]methoxy]but-2-enoxy]-6-methyloxane-3,4,5-triol (PubChem CID 155602445) has the molecular formula C21H37N3O10 and a molecular weight of 491.54 g/mol. Its IUPAC name is (2R,4S,5S)-2-[(Z)-4-[[1-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethyl]triazol-4-yl]methoxy]but-2-enoxy]-6-methyloxane-3,4,5-triol.
| Compound Name | (2R,4S,5S)-2-[(Z)-4-[[1-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethyl]triazol-4-yl]methoxy]but-2-enoxy]-6-methyloxane-3,4,5-triol |
|---|---|
| PubChem CID | 155602445 |
| Molecular Formula | C21H37N3O10 |
| Molecular Weight | 491.54 g/mol |
| Exact Mass | 491.25 |
| IUPAC Name | (2R,4S,5S)-2-[(Z)-4-[[1-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethyl]triazol-4-yl]methoxy]but-2-enoxy]-6-methyloxane-3,4,5-triol |
| SMILES | CC1O[C@@H](OC/C=C\COCc2cn(CCOCCOCCOCCO)nn2)C(O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C21H37N3O10/c1-16-18(26)19(27)20(28)21(34-16)33-7-3-2-6-32-15-17-14-24(23-22-17)4-8-29-10-12-31-13-11-30-9-5-25/h2-3,14,16,18-21,25-28H,4-13,15H2,1H3/b3-2-/t16?,18-,19+,20?,21-/m1/s1 |
| InChIKey | YQWMDOJMZHYMNN-UNLHGRHYSA-N |
| XLogP | -1.76 |
| TPSA | 167.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.54 |
| LogP ≤ 5 | -1.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|