C16H26N4O8 — CID 122630072
(2S)-3-[1-[2-[2-[(3S,4S)-6-acetyl-3,4,5-trihydroxyoxan-2-yl]oxyethoxy]ethyl]triazol-4-yl]-2-aminopropanal (PubChem CID 122630072) has the molecular formula C16H26N4O8 and a molecular weight of 402.40 g/mol. Its IUPAC name is (2S)-3-[1-[2-[2-[(3S,4S)-6-acetyl-3,4,5-trihydroxyoxan-2-yl]oxyethoxy]ethyl]triazol-4-yl]-2-aminopropanal.
| Compound Name | (2S)-3-[1-[2-[2-[(3S,4S)-6-acetyl-3,4,5-trihydroxyoxan-2-yl]oxyethoxy]ethyl]triazol-4-yl]-2-aminopropanal |
|---|---|
| PubChem CID | 122630072 |
| Molecular Formula | C16H26N4O8 |
| Molecular Weight | 402.40 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | (2S)-3-[1-[2-[2-[(3S,4S)-6-acetyl-3,4,5-trihydroxyoxan-2-yl]oxyethoxy]ethyl]triazol-4-yl]-2-aminopropanal |
| SMILES | CC(=O)C1OC(OCCOCCn2cc(C[C@H](N)C=O)nn2)[C@@H](O)[C@@H](O)C1O |
| InChI | InChI=1S/C16H26N4O8/c1-9(22)15-13(24)12(23)14(25)16(28-15)27-5-4-26-3-2-20-7-11(18-19-20)6-10(17)8-21/h7-8,10,12-16,23-25H,2-6,17H2,1H3/t10-,12-,13?,14-,15?,16?/m0/s1 |
| InChIKey | PEZLPKOVAKGBFN-CWPORXISSA-N |
| XLogP | -3.22 |
| TPSA | 179.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.40 |
| LogP ≤ 5 | -3.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|