C12H23N4O5P — CID 170289049
4-[1-(6-amino-6-oxohexyl)triazol-4-yl]butyl dihydrogen phosphate (PubChem CID 170289049) has the molecular formula C12H23N4O5P and a molecular weight of 334.31 g/mol. Its IUPAC name is 4-[1-(6-amino-6-oxohexyl)triazol-4-yl]butyl dihydrogen phosphate.
| Compound Name | 4-[1-(6-amino-6-oxohexyl)triazol-4-yl]butyl dihydrogen phosphate |
|---|---|
| PubChem CID | 170289049 |
| Molecular Formula | C12H23N4O5P |
| Molecular Weight | 334.31 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | 4-[1-(6-amino-6-oxohexyl)triazol-4-yl]butyl dihydrogen phosphate |
| SMILES | NC(=O)CCCCCn1cc(CCCCOP(=O)(O)O)nn1 |
| InChI | InChI=1S/C12H23N4O5P/c13-12(17)7-2-1-4-8-16-10-11(14-15-16)6-3-5-9-21-22(18,19)20/h10H,1-9H2,(H2,13,17)(H2,18,19,20) |
| InChIKey | RERLICYLNMMQCX-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 140.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.31 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|