C12H22O5S — CID 57309659
6-[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)thian-2-yl]hexanal (PubChem CID 57309659) has the molecular formula C12H22O5S and a molecular weight of 278.37 g/mol. Its IUPAC name is 6-[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)thian-2-yl]hexanal.
| Compound Name | 6-[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)thian-2-yl]hexanal |
|---|---|
| PubChem CID | 57309659 |
| Molecular Formula | C12H22O5S |
| Molecular Weight | 278.37 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 6-[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)thian-2-yl]hexanal |
| SMILES | O=CCCCCC[C@H]1S[C@@H](CO)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C12H22O5S/c13-6-4-2-1-3-5-8-10(15)12(17)11(16)9(7-14)18-8/h6,8-12,14-17H,1-5,7H2/t8-,9+,10+,11+,12-/m1/s1 |
| InChIKey | ZSCQEVVPJIMNAE-WTPMCQDGSA-N |
| XLogP | -0.31 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.37 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|