C6H12O3S2 — CID 144617204
(3S,6S)-2-(hydroxymethyl)-6-sulfanylthiane-3,4-diol (PubChem CID 144617204) has the molecular formula C6H12O3S2 and a molecular weight of 196.29 g/mol. Its IUPAC name is (3S,6S)-2-(hydroxymethyl)-6-sulfanylthiane-3,4-diol.
| Compound Name | (3S,6S)-2-(hydroxymethyl)-6-sulfanylthiane-3,4-diol |
|---|---|
| PubChem CID | 144617204 |
| Molecular Formula | C6H12O3S2 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.02 |
| IUPAC Name | (3S,6S)-2-(hydroxymethyl)-6-sulfanylthiane-3,4-diol |
| SMILES | OCC1S[C@H](S)CC(O)[C@@H]1O |
| InChI | InChI=1S/C6H12O3S2/c7-2-4-6(9)3(8)1-5(10)11-4/h3-10H,1-2H2/t3?,4?,5-,6-/m0/s1 |
| InChIKey | VXEPORDZIOQQCI-ULOPGSAPSA-N |
| XLogP | -0.54 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|