C6H12O3 — CID 57158544
4-(hydroxymethyl)cyclopentane-1,3-diol (PubChem CID 57158544) has the molecular formula C6H12O3 and a molecular weight of 132.16 g/mol. Its IUPAC name is 4-(hydroxymethyl)cyclopentane-1,3-diol.
| Compound Name | 4-(hydroxymethyl)cyclopentane-1,3-diol |
|---|---|
| PubChem CID | 57158544 |
| Molecular Formula | C6H12O3 |
| Molecular Weight | 132.16 g/mol |
| Exact Mass | 132.08 |
| IUPAC Name | 4-(hydroxymethyl)cyclopentane-1,3-diol |
| SMILES | OCC1CC(O)CC1O |
| InChI | InChI=1S/C6H12O3/c7-3-4-1-5(8)2-6(4)9/h4-9H,1-3H2 |
| InChIKey | HXUPUZHHZBLALZ-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.16 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |