C7H14O4 — CID 148585059
5-(hydroxymethyl)cyclohexane-1,2,4-triol (PubChem CID 148585059) has the molecular formula C7H14O4 and a molecular weight of 162.18 g/mol. Its IUPAC name is 5-(hydroxymethyl)cyclohexane-1,2,4-triol.
| Compound Name | 5-(hydroxymethyl)cyclohexane-1,2,4-triol |
|---|---|
| PubChem CID | 148585059 |
| Molecular Formula | C7H14O4 |
| Molecular Weight | 162.18 g/mol |
| Exact Mass | 162.09 |
| IUPAC Name | 5-(hydroxymethyl)cyclohexane-1,2,4-triol |
| SMILES | OCC1CC(O)C(O)CC1O |
| InChI | InChI=1S/C7H14O4/c8-3-4-1-6(10)7(11)2-5(4)9/h4-11H,1-3H2 |
| InChIKey | MZNIDZHTAXURGT-UHFFFAOYSA-N |
| XLogP | -1.53 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.18 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |