C7H14O3 — CID 130149312
2-(hydroxymethyl)cyclohexane-1,4-diol (PubChem CID 130149312) has the molecular formula C7H14O3 and a molecular weight of 146.19 g/mol. Its IUPAC name is 2-(hydroxymethyl)cyclohexane-1,4-diol.
| Compound Name | 2-(hydroxymethyl)cyclohexane-1,4-diol |
|---|---|
| PubChem CID | 130149312 |
| Molecular Formula | C7H14O3 |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.09 |
| IUPAC Name | 2-(hydroxymethyl)cyclohexane-1,4-diol |
| SMILES | OCC1CC(O)CCC1O |
| InChI | InChI=1S/C7H14O3/c8-4-5-3-6(9)1-2-7(5)10/h5-10H,1-4H2 |
| InChIKey | AUAPMQNZKKUZIS-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |