C9H18O4 — CID 175425260
2,3,4-tris(hydroxymethyl)cyclohexan-1-ol (PubChem CID 175425260) has the molecular formula C9H18O4 and a molecular weight of 190.24 g/mol. Its IUPAC name is 2,3,4-tris(hydroxymethyl)cyclohexan-1-ol.
| Compound Name | 2,3,4-tris(hydroxymethyl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 175425260 |
| Molecular Formula | C9H18O4 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | 2,3,4-tris(hydroxymethyl)cyclohexan-1-ol |
| SMILES | OCC1CCC(O)C(CO)C1CO |
| InChI | InChI=1S/C9H18O4/c10-3-6-1-2-9(13)8(5-12)7(6)4-11/h6-13H,1-5H2 |
| InChIKey | FWLWBUMWHIFKKY-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |