C7H13NO2 — CID 89122843
4-amino-2-methylcyclopentane-1-carboxylic acid (PubChem CID 89122843) has the molecular formula C7H13NO2 and a molecular weight of 143.19 g/mol. Its IUPAC name is 4-amino-2-methylcyclopentane-1-carboxylic acid.
| Compound Name | 4-amino-2-methylcyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 89122843 |
| Molecular Formula | C7H13NO2 |
| Molecular Weight | 143.19 g/mol |
| Exact Mass | 143.09 |
| IUPAC Name | 4-amino-2-methylcyclopentane-1-carboxylic acid |
| SMILES | CC1CC(N)CC1C(=O)O |
| InChI | InChI=1S/C7H13NO2/c1-4-2-5(8)3-6(4)7(9)10/h4-6H,2-3,8H2,1H3,(H,9,10) |
| InChIKey | RHITYWUHRYXDRO-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.19 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |