C9H16Br2 — CID 98513794
(1S,2R,3R,4R,5S)-1,2-dibromo-3,4,5-trimethylcyclohexane (PubChem CID 98513794) has the molecular formula C9H16Br2 and a molecular weight of 284.04 g/mol. Its IUPAC name is (1S,2R,3R,4R,5S)-1,2-dibromo-3,4,5-trimethylcyclohexane.
| Compound Name | (1S,2R,3R,4R,5S)-1,2-dibromo-3,4,5-trimethylcyclohexane |
|---|---|
| PubChem CID | 98513794 |
| Molecular Formula | C9H16Br2 |
| Molecular Weight | 284.04 g/mol |
| Exact Mass | 281.96 |
| IUPAC Name | (1S,2R,3R,4R,5S)-1,2-dibromo-3,4,5-trimethylcyclohexane |
| SMILES | C[C@@H]1[C@H](C)[C@@H](C)C[C@H](Br)[C@@H]1Br |
| InChI | InChI=1S/C9H16Br2/c1-5-4-8(10)9(11)7(3)6(5)2/h5-9H,4H2,1-3H3/t5-,6+,7+,8-,9+/m0/s1 |
| InChIKey | WXAASQRFNWAVIQ-JTPBWFLFSA-N |
| XLogP | 3.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.04 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|