C6H14ClP — CID 19777739
1,1-dimethylphospholan-1-ium chloride (PubChem CID 19777739) has the molecular formula C6H14ClP and a molecular weight of 152.61 g/mol. Its IUPAC name is 1,1-dimethylphospholan-1-ium chloride.
| Compound Name | 1,1-dimethylphospholan-1-ium chloride |
|---|---|
| PubChem CID | 19777739 |
| Molecular Formula | C6H14ClP |
| Molecular Weight | 152.61 g/mol |
| Exact Mass | 152.05 |
| IUPAC Name | 1,1-dimethylphospholan-1-ium chloride |
| SMILES | C[P+]1(C)CCCC1.[Cl-] |
| InChI | InChI=1S/C6H14P.ClH/c1-7(2)5-3-4-6-7;/h3-6H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | BWOMIBGLJHORKG-UHFFFAOYSA-M |
| XLogP | -0.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.61 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|