C20H37ClFe — CID 162299054
1-(2-chloroethenyl)-2,3,4,5-tetramethylcyclopentane;iron;1,2,3,4-tetramethylcyclopentane (PubChem CID 162299054) has the molecular formula C20H37ClFe and a molecular weight of 368.81 g/mol. Its IUPAC name is 1-(2-chloroethenyl)-2,3,4,5-tetramethylcyclopentane;iron;1,2,3,4-tetramethylcyclopentane.
| Compound Name | 1-(2-chloroethenyl)-2,3,4,5-tetramethylcyclopentane;iron;1,2,3,4-tetramethylcyclopentane |
|---|---|
| PubChem CID | 162299054 |
| Molecular Formula | C20H37ClFe |
| Molecular Weight | 368.81 g/mol |
| Exact Mass | 368.19 |
| IUPAC Name | 1-(2-chloroethenyl)-2,3,4,5-tetramethylcyclopentane;iron;1,2,3,4-tetramethylcyclopentane |
| SMILES | CC1C(C)C(C)C(C=CCl)C1C.CC1CC(C)C(C)C1C.[Fe] |
| InChI | InChI=1S/C11H19Cl.C9H18.Fe/c1-7-8(2)10(4)11(5-6-12)9(7)3;1-6-5-7(2)9(4)8(6)3;/h5-11H,1-4H3;6-9H,5H2,1-4H3; |
| InChIKey | JQOBKNPCBYPKBH-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.81 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|