C10H18 — CID 123646174
2-but-1-enyl-1,3-dimethylcyclobutane (PubChem CID 123646174) has the molecular formula C10H18 and a molecular weight of 138.25 g/mol. Its IUPAC name is 2-but-1-enyl-1,3-dimethylcyclobutane.
| Compound Name | 2-but-1-enyl-1,3-dimethylcyclobutane |
|---|---|
| PubChem CID | 123646174 |
| Molecular Formula | C10H18 |
| Molecular Weight | 138.25 g/mol |
| Exact Mass | 138.14 |
| IUPAC Name | 2-but-1-enyl-1,3-dimethylcyclobutane |
| SMILES | CCC=CC1C(C)CC1C |
| InChI | InChI=1S/C10H18/c1-4-5-6-10-8(2)7-9(10)3/h5-6,8-10H,4,7H2,1-3H3 |
| InChIKey | CXSLKBDSGYJQGZ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.25 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|