C14H28 — CID 91175981
1,1-dimethyl-2-(3,4,5-trimethylhexan-2-yl)cyclopropane (PubChem CID 91175981) has the molecular formula C14H28 and a molecular weight of 196.38 g/mol. Its IUPAC name is 1,1-dimethyl-2-(3,4,5-trimethylhexan-2-yl)cyclopropane.
| Compound Name | 1,1-dimethyl-2-(3,4,5-trimethylhexan-2-yl)cyclopropane |
|---|---|
| PubChem CID | 91175981 |
| Molecular Formula | C14H28 |
| Molecular Weight | 196.38 g/mol |
| Exact Mass | 196.22 |
| IUPAC Name | 1,1-dimethyl-2-(3,4,5-trimethylhexan-2-yl)cyclopropane |
| SMILES | CC(C)C(C)C(C)C(C)C1CC1(C)C |
| InChI | InChI=1S/C14H28/c1-9(2)10(3)11(4)12(5)13-8-14(13,6)7/h9-13H,8H2,1-7H3 |
| InChIKey | MLFNVEJTTWHULC-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.38 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |