C8H14Cl2 — CID 146435893
(2R)-1,1-dichloro-2-[(2S)-3-methylbutan-2-yl]cyclopropane (PubChem CID 146435893) has the molecular formula C8H14Cl2 and a molecular weight of 181.11 g/mol. Its IUPAC name is (2R)-1,1-dichloro-2-[(2S)-3-methylbutan-2-yl]cyclopropane.
| Compound Name | (2R)-1,1-dichloro-2-[(2S)-3-methylbutan-2-yl]cyclopropane |
|---|---|
| PubChem CID | 146435893 |
| Molecular Formula | C8H14Cl2 |
| Molecular Weight | 181.11 g/mol |
| Exact Mass | 180.05 |
| IUPAC Name | (2R)-1,1-dichloro-2-[(2S)-3-methylbutan-2-yl]cyclopropane |
| SMILES | CC(C)[C@H](C)[C@H]1CC1(Cl)Cl |
| InChI | InChI=1S/C8H14Cl2/c1-5(2)6(3)7-4-8(7,9)10/h5-7H,4H2,1-3H3/t6-,7+/m0/s1 |
| InChIKey | FJYVVURRRFLXLD-NKWVEPMBSA-N |
| XLogP | 3.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.11 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|