C9H17Cl2N — CID 125477604
(1R)-1-[(1S)-2,2-dichlorocyclopropyl]-N,N-diethylethanamine (PubChem CID 125477604) has the molecular formula C9H17Cl2N and a molecular weight of 210.15 g/mol. Its IUPAC name is (1R)-1-[(1S)-2,2-dichlorocyclopropyl]-N,N-diethylethanamine.
| Compound Name | (1R)-1-[(1S)-2,2-dichlorocyclopropyl]-N,N-diethylethanamine |
|---|---|
| PubChem CID | 125477604 |
| Molecular Formula | C9H17Cl2N |
| Molecular Weight | 210.15 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | (1R)-1-[(1S)-2,2-dichlorocyclopropyl]-N,N-diethylethanamine |
| SMILES | CCN(CC)[C@H](C)[C@@H]1CC1(Cl)Cl |
| InChI | InChI=1S/C9H17Cl2N/c1-4-12(5-2)7(3)8-6-9(8,10)11/h7-8H,4-6H2,1-3H3/t7-,8+/m1/s1 |
| InChIKey | GMZVPVOJGBHXDP-SFYZADRCSA-N |
| XLogP | 2.91 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.15 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|