C5H10Cl3N — CID 118207124
(1S)-1-[(1S)-2,2-dichlorocyclopropyl]ethanamine;hydrochloride (PubChem CID 118207124) has the molecular formula C5H10Cl3N and a molecular weight of 190.50 g/mol. Its IUPAC name is (1S)-1-[(1S)-2,2-dichlorocyclopropyl]ethanamine;hydrochloride.
| Compound Name | (1S)-1-[(1S)-2,2-dichlorocyclopropyl]ethanamine;hydrochloride |
|---|---|
| PubChem CID | 118207124 |
| Molecular Formula | C5H10Cl3N |
| Molecular Weight | 190.50 g/mol |
| Exact Mass | 188.99 |
| IUPAC Name | (1S)-1-[(1S)-2,2-dichlorocyclopropyl]ethanamine;hydrochloride |
| SMILES | C[C@H](N)[C@@H]1CC1(Cl)Cl.Cl |
| InChI | InChI=1S/C5H9Cl2N.ClH/c1-3(8)4-2-5(4,6)7;/h3-4H,2,8H2,1H3;1H/t3-,4-;/m0./s1 |
| InChIKey | JVHRGLXYUAIUIE-MMALYQPHSA-N |
| XLogP | 1.95 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.50 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|