C12H19Cl2NO — CID 78838416
2,2-dichloro-N-cyclohexyl-N-ethylcyclopropane-1-carboxamide (PubChem CID 78838416) has the molecular formula C12H19Cl2NO and a molecular weight of 264.20 g/mol. Its IUPAC name is 2,2-dichloro-N-cyclohexyl-N-ethylcyclopropane-1-carboxamide.
| Compound Name | 2,2-dichloro-N-cyclohexyl-N-ethylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 78838416 |
| Molecular Formula | C12H19Cl2NO |
| Molecular Weight | 264.20 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | 2,2-dichloro-N-cyclohexyl-N-ethylcyclopropane-1-carboxamide |
| SMILES | CCN(C(=O)C1CC1(Cl)Cl)C1CCCCC1 |
| InChI | InChI=1S/C12H19Cl2NO/c1-2-15(9-6-4-3-5-7-9)11(16)10-8-12(10,13)14/h9-10H,2-8H2,1H3 |
| InChIKey | YJLIFLLMOJQFPX-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.20 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|