C28H56 — CID 123653501
2-(10-ethyl-3,4,6,8,11,12-hexamethylpentadecan-2-yl)-1,1-dimethylcyclopropane (PubChem CID 123653501) has the molecular formula C28H56 and a molecular weight of 392.76 g/mol. Its IUPAC name is 2-(10-ethyl-3,4,6,8,11,12-hexamethylpentadecan-2-yl)-1,1-dimethylcyclopropane.
| Compound Name | 2-(10-ethyl-3,4,6,8,11,12-hexamethylpentadecan-2-yl)-1,1-dimethylcyclopropane |
|---|---|
| PubChem CID | 123653501 |
| Molecular Formula | C28H56 |
| Molecular Weight | 392.76 g/mol |
| Exact Mass | 392.44 |
| IUPAC Name | 2-(10-ethyl-3,4,6,8,11,12-hexamethylpentadecan-2-yl)-1,1-dimethylcyclopropane |
| SMILES | CCCC(C)C(C)C(CC)CC(C)CC(C)CC(C)C(C)C(C)C1CC1(C)C |
| InChI | InChI=1S/C28H56/c1-12-14-21(5)24(8)26(13-2)17-20(4)15-19(3)16-22(6)23(7)25(9)27-18-28(27,10)11/h19-27H,12-18H2,1-11H3 |
| InChIKey | VBVMOGROWFOPQO-UHFFFAOYSA-N |
| XLogP | 9.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.76 |
| LogP ≤ 5 | 9.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |