About 2-(4,5-dimethylheptan-3-yl)-1,1-dimethylcyclopropane
2-(4,5-dimethylheptan-3-yl)-1,1-dimethylcyclopropane (PubChem CID 90861114) has the molecular formula C14H28
and a molecular weight of 196.38 g/mol. Its IUPAC name is 2-(4,5-dimethylheptan-3-yl)-1,1-dimethylcyclopropane.
Analyze 2-(4,5-dimethylheptan-3-yl)-1,1-dimethylcyclopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,5-dimethylheptan-3-yl)-1,1-dimethylcyclopropane?
The IUPAC name of 2-(4,5-dimethylheptan-3-yl)-1,1-dimethylcyclopropane (CID 90861114) is 2-(4,5-dimethylheptan-3-yl)-1,1-dimethylcyclopropane.
What is the SMILES notation for 2-(4,5-dimethylheptan-3-yl)-1,1-dimethylcyclopropane?
The canonical SMILES for 2-(4,5-dimethylheptan-3-yl)-1,1-dimethylcyclopropane is CCC(C)C(C)C(CC)C1CC1(C)C.
What is the InChIKey of 2-(4,5-dimethylheptan-3-yl)-1,1-dimethylcyclopropane?
The InChIKey is VXYMZCIPXIWDKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28/c1-7-10(3)11(4)12(8-2)13-9-14(13,5)6/h10-13H,7-9H2,1-6H3.
What are the key properties of 2-(4,5-dimethylheptan-3-yl)-1,1-dimethylcyclopropane?
2-(4,5-dimethylheptan-3-yl)-1,1-dimethylcyclopropane has a molecular weight of 196.38 g/mol, XLogP of 4.74, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,5-dimethylheptan-3-yl)-1,1-dimethylcyclopropane is sourced from PubChem (CID 90861114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).