C14H30 — CID 23652
2,2,3,3,5,6,6-heptamethylheptane (PubChem CID 23652) has the molecular formula C14H30 and a molecular weight of 198.39 g/mol. Its IUPAC name is 2,2,3,3,5,6,6-heptamethylheptane.
| Compound Name | 2,2,3,3,5,6,6-heptamethylheptane |
|---|---|
| PubChem CID | 23652 |
| Molecular Formula | C14H30 |
| Molecular Weight | 198.39 g/mol |
| Exact Mass | 198.23 |
| IUPAC Name | 2,2,3,3,5,6,6-heptamethylheptane |
| SMILES | CC(CC(C)(C)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C14H30/c1-11(12(2,3)4)10-14(8,9)13(5,6)7/h11H,10H2,1-9H3 |
| InChIKey | OTNCYIBPUVFLLZ-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.39 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |