C8H19NO — CID 87675780
3,4-dimethylpentan-2-yloxymethanamine (PubChem CID 87675780) has the molecular formula C8H19NO and a molecular weight of 145.25 g/mol. Its IUPAC name is 3,4-dimethylpentan-2-yloxymethanamine.
| Compound Name | 3,4-dimethylpentan-2-yloxymethanamine |
|---|---|
| PubChem CID | 87675780 |
| Molecular Formula | C8H19NO |
| Molecular Weight | 145.25 g/mol |
| Exact Mass | 145.15 |
| IUPAC Name | 3,4-dimethylpentan-2-yloxymethanamine |
| SMILES | CC(C)C(C)C(C)OCN |
| InChI | InChI=1S/C8H19NO/c1-6(2)7(3)8(4)10-5-9/h6-8H,5,9H2,1-4H3 |
| InChIKey | IRLHUWJVBVVERL-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.25 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|