C9H20O2 — CID 59039577
(3R,4R)-4-ethoxy-5-methylhexan-3-ol (PubChem CID 59039577) has the molecular formula C9H20O2 and a molecular weight of 160.26 g/mol. Its IUPAC name is (3R,4R)-4-ethoxy-5-methylhexan-3-ol.
| Compound Name | (3R,4R)-4-ethoxy-5-methylhexan-3-ol |
|---|---|
| PubChem CID | 59039577 |
| Molecular Formula | C9H20O2 |
| Molecular Weight | 160.26 g/mol |
| Exact Mass | 160.15 |
| IUPAC Name | (3R,4R)-4-ethoxy-5-methylhexan-3-ol |
| SMILES | CCO[C@H](C(C)C)[C@H](O)CC |
| InChI | InChI=1S/C9H20O2/c1-5-8(10)9(7(3)4)11-6-2/h7-10H,5-6H2,1-4H3/t8-,9-/m1/s1 |
| InChIKey | NONCZFJEYPMTNX-RKDXNWHRSA-N |
| XLogP | 1.82 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.26 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |