C4H11NO2 — CID 148517870
(2R)-2-aminobutane-1,1-diol (PubChem CID 148517870) has the molecular formula C4H11NO2 and a molecular weight of 105.14 g/mol. Its IUPAC name is (2R)-2-aminobutane-1,1-diol.
| Compound Name | (2R)-2-aminobutane-1,1-diol |
|---|---|
| PubChem CID | 148517870 |
| Molecular Formula | C4H11NO2 |
| Molecular Weight | 105.14 g/mol |
| Exact Mass | 105.08 |
| IUPAC Name | (2R)-2-aminobutane-1,1-diol |
| SMILES | CC[C@@H](N)C(O)O |
| InChI | InChI=1S/C4H11NO2/c1-2-3(5)4(6)7/h3-4,6-7H,2,5H2,1H3/t3-/m1/s1 |
| InChIKey | MNUPQNLRUOASLG-GSVOUGTGSA-N |
| XLogP | -0.97 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 105.14 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|