C15H30O — CID 143066011
acetylene;ethane;(Z,5S)-6-ethylnon-2-en-5-ol (PubChem CID 143066011) has the molecular formula C15H30O and a molecular weight of 226.40 g/mol. Its IUPAC name is acetylene;ethane;(Z,5S)-6-ethylnon-2-en-5-ol.
| Compound Name | acetylene;ethane;(Z,5S)-6-ethylnon-2-en-5-ol |
|---|---|
| PubChem CID | 143066011 |
| Molecular Formula | C15H30O |
| Molecular Weight | 226.40 g/mol |
| Exact Mass | 226.23 |
| IUPAC Name | acetylene;ethane;(Z,5S)-6-ethylnon-2-en-5-ol |
| SMILES | C#C.C/C=C\C[C@H](O)C(CC)CCC.CC |
| InChI | InChI=1S/C11H22O.C2H6.C2H2/c1-4-7-9-11(12)10(6-3)8-5-2;2*1-2/h4,7,10-12H,5-6,8-9H2,1-3H3;1-2H3;1-2H/b7-4-;;/t10?,11-;;/m0../s1 |
| InChIKey | AGBQSDKZVPKAPK-KSGDNYJJSA-N |
| XLogP | 4.42 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.40 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|