C21H26ClNO — CID 171260723
(1R,2S)-1-amino-1-anthracen-9-yl-5-methylhexan-2-ol;hydrochloride (PubChem CID 171260723) has the molecular formula C21H26ClNO and a molecular weight of 343.90 g/mol. Its IUPAC name is (1R,2S)-1-amino-1-anthracen-9-yl-5-methylhexan-2-ol;hydrochloride.
| Compound Name | (1R,2S)-1-amino-1-anthracen-9-yl-5-methylhexan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 171260723 |
| Molecular Formula | C21H26ClNO |
| Molecular Weight | 343.90 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | (1R,2S)-1-amino-1-anthracen-9-yl-5-methylhexan-2-ol;hydrochloride |
| SMILES | CC(C)CC[C@H](O)[C@H](N)c1c2ccccc2cc2ccccc12.Cl |
| InChI | InChI=1S/C21H25NO.ClH/c1-14(2)11-12-19(23)21(22)20-17-9-5-3-7-15(17)13-16-8-4-6-10-18(16)20;/h3-10,13-14,19,21,23H,11-12,22H2,1-2H3;1H/t19-,21-;/m0./s1 |
| InChIKey | VYOUVPSOKGBILY-RQBPZYBGSA-N |
| XLogP | 5.21 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.90 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|