C13H16ClNO2 — CID 171264640
1-[(1R,2S)-1-amino-2-hydroxypropyl]naphthalen-2-ol;hydrochloride (PubChem CID 171264640) has the molecular formula C13H16ClNO2 and a molecular weight of 253.73 g/mol. Its IUPAC name is 1-[(1R,2S)-1-amino-2-hydroxypropyl]naphthalen-2-ol;hydrochloride.
| Compound Name | 1-[(1R,2S)-1-amino-2-hydroxypropyl]naphthalen-2-ol;hydrochloride |
|---|---|
| PubChem CID | 171264640 |
| Molecular Formula | C13H16ClNO2 |
| Molecular Weight | 253.73 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | 1-[(1R,2S)-1-amino-2-hydroxypropyl]naphthalen-2-ol;hydrochloride |
| SMILES | C[C@H](O)[C@H](N)c1c(O)ccc2ccccc12.Cl |
| InChI | InChI=1S/C13H15NO2.ClH/c1-8(15)13(14)12-10-5-3-2-4-9(10)6-7-11(12)16;/h2-8,13,15-16H,14H2,1H3;1H/t8-,13-;/m0./s1 |
| InChIKey | LOVQYAAAMSKKMA-GAYVKDPFSA-N |
| XLogP | 2.35 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.73 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|