C13H11ClF5N — CID 171312597
(1R)-2,2,3,3,3-pentafluoro-1-naphthalen-1-ylpropan-1-amine;hydrochloride (PubChem CID 171312597) has the molecular formula C13H11ClF5N and a molecular weight of 311.68 g/mol. Its IUPAC name is (1R)-2,2,3,3,3-pentafluoro-1-naphthalen-1-ylpropan-1-amine;hydrochloride.
| Compound Name | (1R)-2,2,3,3,3-pentafluoro-1-naphthalen-1-ylpropan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171312597 |
| Molecular Formula | C13H11ClF5N |
| Molecular Weight | 311.68 g/mol |
| Exact Mass | 311.05 |
| IUPAC Name | (1R)-2,2,3,3,3-pentafluoro-1-naphthalen-1-ylpropan-1-amine;hydrochloride |
| SMILES | Cl.N[C@H](c1cccc2ccccc12)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H10F5N.ClH/c14-12(15,13(16,17)18)11(19)10-7-3-5-8-4-1-2-6-9(8)10;/h1-7,11H,19H2;1H/t11-;/m1./s1 |
| InChIKey | BMGKBALLYWFWAQ-RFVHGSKJSA-N |
| XLogP | 4.46 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.68 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|