C12H19FN2O — CID 171224881
(1S)-1-(4-fluoro-2-methoxyphenyl)pentane-1,5-diamine (PubChem CID 171224881) has the molecular formula C12H19FN2O and a molecular weight of 226.29 g/mol. Its IUPAC name is (1S)-1-(4-fluoro-2-methoxyphenyl)pentane-1,5-diamine.
| Compound Name | (1S)-1-(4-fluoro-2-methoxyphenyl)pentane-1,5-diamine |
|---|---|
| PubChem CID | 171224881 |
| Molecular Formula | C12H19FN2O |
| Molecular Weight | 226.29 g/mol |
| Exact Mass | 226.15 |
| IUPAC Name | (1S)-1-(4-fluoro-2-methoxyphenyl)pentane-1,5-diamine |
| SMILES | COc1cc(F)ccc1[C@@H](N)CCCCN |
| InChI | InChI=1S/C12H19FN2O/c1-16-12-8-9(13)5-6-10(12)11(15)4-2-3-7-14/h5-6,8,11H,2-4,7,14-15H2,1H3/t11-/m0/s1 |
| InChIKey | XIIQQAHVNJUQTN-NSHDSACASA-N |
| XLogP | 1.96 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.29 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|