C14H18Cl2N2 — CID 171251439
(1R)-1-(2-chloroquinolin-3-yl)-2,2-dimethylpropan-1-amine;hydrochloride (PubChem CID 171251439) has the molecular formula C14H18Cl2N2 and a molecular weight of 285.22 g/mol. Its IUPAC name is (1R)-1-(2-chloroquinolin-3-yl)-2,2-dimethylpropan-1-amine;hydrochloride.
| Compound Name | (1R)-1-(2-chloroquinolin-3-yl)-2,2-dimethylpropan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171251439 |
| Molecular Formula | C14H18Cl2N2 |
| Molecular Weight | 285.22 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | (1R)-1-(2-chloroquinolin-3-yl)-2,2-dimethylpropan-1-amine;hydrochloride |
| SMILES | CC(C)(C)[C@@H](N)c1cc2ccccc2nc1Cl.Cl |
| InChI | InChI=1S/C14H17ClN2.ClH/c1-14(2,3)12(16)10-8-9-6-4-5-7-11(9)17-13(10)15;/h4-8,12H,16H2,1-3H3;1H/t12-;/m0./s1 |
| InChIKey | IILQVEWIHUZDOP-YDALLXLXSA-N |
| XLogP | 4.36 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.22 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|