C25H28N4 — CID 163409701
2,2-dimethyl-1,3-bis(2-methylquinolin-3-yl)propane-1,3-diamine (PubChem CID 163409701) has the molecular formula C25H28N4 and a molecular weight of 384.53 g/mol. Its IUPAC name is 2,2-dimethyl-1,3-bis(2-methylquinolin-3-yl)propane-1,3-diamine.
| Compound Name | 2,2-dimethyl-1,3-bis(2-methylquinolin-3-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 163409701 |
| Molecular Formula | C25H28N4 |
| Molecular Weight | 384.53 g/mol |
| Exact Mass | 384.23 |
| IUPAC Name | 2,2-dimethyl-1,3-bis(2-methylquinolin-3-yl)propane-1,3-diamine |
| SMILES | Cc1nc2ccccc2cc1C(N)C(C)(C)C(N)c1cc2ccccc2nc1C |
| InChI | InChI=1S/C25H28N4/c1-15-19(13-17-9-5-7-11-21(17)28-15)23(26)25(3,4)24(27)20-14-18-10-6-8-12-22(18)29-16(20)2/h5-14,23-24H,26-27H2,1-4H3 |
| InChIKey | YXQJILBFHCADCA-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.53 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |