C14H15F2N — CID 171313788
(1R)-3,3-difluoro-1-(4-methylnaphthalen-1-yl)propan-1-amine (PubChem CID 171313788) has the molecular formula C14H15F2N and a molecular weight of 235.28 g/mol. Its IUPAC name is (1R)-3,3-difluoro-1-(4-methylnaphthalen-1-yl)propan-1-amine.
| Compound Name | (1R)-3,3-difluoro-1-(4-methylnaphthalen-1-yl)propan-1-amine |
|---|---|
| PubChem CID | 171313788 |
| Molecular Formula | C14H15F2N |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | (1R)-3,3-difluoro-1-(4-methylnaphthalen-1-yl)propan-1-amine |
| SMILES | Cc1ccc([C@H](N)CC(F)F)c2ccccc12 |
| InChI | InChI=1S/C14H15F2N/c1-9-6-7-12(13(17)8-14(15)16)11-5-3-2-4-10(9)11/h2-7,13-14H,8,17H2,1H3/t13-/m1/s1 |
| InChIKey | JANOGQJMITWJQJ-CYBMUJFWSA-N |
| XLogP | 3.80 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |