C9H15N3O — CID 55294728
(1S,2S)-1-amino-1-(2,3-diaminophenyl)propan-2-ol (PubChem CID 55294728) has the molecular formula C9H15N3O and a molecular weight of 181.24 g/mol. Its IUPAC name is (1S,2S)-1-amino-1-(2,3-diaminophenyl)propan-2-ol.
| Compound Name | (1S,2S)-1-amino-1-(2,3-diaminophenyl)propan-2-ol |
|---|---|
| PubChem CID | 55294728 |
| Molecular Formula | C9H15N3O |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.12 |
| IUPAC Name | (1S,2S)-1-amino-1-(2,3-diaminophenyl)propan-2-ol |
| SMILES | C[C@H](O)[C@@H](N)c1cccc(N)c1N |
| InChI | InChI=1S/C9H15N3O/c1-5(13)8(11)6-3-2-4-7(10)9(6)12/h2-5,8,13H,10-12H2,1H3/t5-,8+/m0/s1 |
| InChIKey | VANWFQXSFCQFRU-YLWLKBPMSA-N |
| XLogP | 0.23 |
| TPSA | 98.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|