C8H12N2O — CID 18668016
1-(2,3-diaminophenyl)ethanol (PubChem CID 18668016) has the molecular formula C8H12N2O and a molecular weight of 152.20 g/mol. Its IUPAC name is 1-(2,3-diaminophenyl)ethanol.
| Compound Name | 1-(2,3-diaminophenyl)ethanol |
|---|---|
| PubChem CID | 18668016 |
| Molecular Formula | C8H12N2O |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.09 |
| IUPAC Name | 1-(2,3-diaminophenyl)ethanol |
| SMILES | CC(O)c1cccc(N)c1N |
| InChI | InChI=1S/C8H12N2O/c1-5(11)6-3-2-4-7(9)8(6)10/h2-5,11H,9-10H2,1H3 |
| InChIKey | NYWFRRXETZKDJM-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|