C14H16N2O2 — CID 166060261
(1S,2S)-1,2-bis(2-aminophenyl)ethane-1,2-diol (PubChem CID 166060261) has the molecular formula C14H16N2O2 and a molecular weight of 244.29 g/mol. Its IUPAC name is (1S,2S)-1,2-bis(2-aminophenyl)ethane-1,2-diol.
| Compound Name | (1S,2S)-1,2-bis(2-aminophenyl)ethane-1,2-diol |
|---|---|
| PubChem CID | 166060261 |
| Molecular Formula | C14H16N2O2 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | (1S,2S)-1,2-bis(2-aminophenyl)ethane-1,2-diol |
| SMILES | Nc1ccccc1[C@H](O)[C@@H](O)c1ccccc1N |
| InChI | InChI=1S/C14H16N2O2/c15-11-7-3-1-5-9(11)13(17)14(18)10-6-2-4-8-12(10)16/h1-8,13-14,17-18H,15-16H2/t13-,14-/m0/s1 |
| InChIKey | VNRYBZHRNXMEOK-KBPBESRZSA-N |
| XLogP | 1.62 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|