C10H15NO — CID 131028904
(2S,3S)-3-(2-aminophenyl)butan-2-ol (PubChem CID 131028904) has the molecular formula C10H15NO and a molecular weight of 165.24 g/mol. Its IUPAC name is (2S,3S)-3-(2-aminophenyl)butan-2-ol.
| Compound Name | (2S,3S)-3-(2-aminophenyl)butan-2-ol |
|---|---|
| PubChem CID | 131028904 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | (2S,3S)-3-(2-aminophenyl)butan-2-ol |
| SMILES | C[C@H](O)[C@@H](C)c1ccccc1N |
| InChI | InChI=1S/C10H15NO/c1-7(8(2)12)9-5-3-4-6-10(9)11/h3-8,12H,11H2,1-2H3/t7-,8+/m1/s1 |
| InChIKey | MUDMBMNTJINKMI-SFYZADRCSA-N |
| XLogP | 1.75 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|