C9H13FN2O — CID 131123791
(1S,2S)-1-amino-1-(3-amino-2-fluorophenyl)propan-2-ol (PubChem CID 131123791) has the molecular formula C9H13FN2O and a molecular weight of 184.21 g/mol. Its IUPAC name is (1S,2S)-1-amino-1-(3-amino-2-fluorophenyl)propan-2-ol.
| Compound Name | (1S,2S)-1-amino-1-(3-amino-2-fluorophenyl)propan-2-ol |
|---|---|
| PubChem CID | 131123791 |
| Molecular Formula | C9H13FN2O |
| Molecular Weight | 184.21 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | (1S,2S)-1-amino-1-(3-amino-2-fluorophenyl)propan-2-ol |
| SMILES | C[C@H](O)[C@@H](N)c1cccc(N)c1F |
| InChI | InChI=1S/C9H13FN2O/c1-5(13)9(12)6-3-2-4-7(11)8(6)10/h2-5,9,13H,11-12H2,1H3/t5-,9+/m0/s1 |
| InChIKey | CVAKMCNDUGLGKB-SSDLBLMSSA-N |
| XLogP | 0.79 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.21 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|