About [(1R,2S)-2-azaniumyl-1,2-bis(2-hydroxyphenyl)ethyl]azanium dichloride
[(1R,2S)-2-azaniumyl-1,2-bis(2-hydroxyphenyl)ethyl]azanium dichloride (PubChem CID 139065315) has the molecular formula C14H18Cl2N2O2
and a molecular weight of 317.22 g/mol. Its IUPAC name is [(1R,2S)-2-azaniumyl-1,2-bis(2-hydroxyphenyl)ethyl]azanium dichloride.
Molecular Properties
| Compound Name | [(1R,2S)-2-azaniumyl-1,2-bis(2-hydroxyphenyl)ethyl]azanium dichloride |
| PubChem CID | 139065315 |
| Molecular Formula | C14H18Cl2N2O2 |
| Molecular Weight | 317.22 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | [(1R,2S)-2-azaniumyl-1,2-bis(2-hydroxyphenyl)ethyl]azanium dichloride |
| SMILES | [Cl-].[Cl-].[NH3+][C@H](c1ccccc1O)[C@@H]([NH3+])c1ccccc1O |
| InChI | InChI=1S/C14H16N2O2.2ClH/c15-13(9-5-1-3-7-11(9)17)14(16)10-6-2-4-8-12(10)18;;/h1-8,13-14,17-18H,15-16H2;2*1H/t13-,14+;; |
| InChIKey | FSQLRMWRYPBIRJ-DUFSSLHGSA-N |
| XLogP | -5.63 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.22 |
| LogP ≤ 5 | -5.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|
Analyze [(1R,2S)-2-azaniumyl-1,2-bis(2-hydroxyphenyl)ethyl]azanium dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,2S)-2-azaniumyl-1,2-bis(2-hydroxyphenyl)ethyl]azanium dichloride?
The IUPAC name of [(1R,2S)-2-azaniumyl-1,2-bis(2-hydroxyphenyl)ethyl]azanium dichloride (CID 139065315) is [(1R,2S)-2-azaniumyl-1,2-bis(2-hydroxyphenyl)ethyl]azanium dichloride.
What is the SMILES notation for [(1R,2S)-2-azaniumyl-1,2-bis(2-hydroxyphenyl)ethyl]azanium dichloride?
The canonical SMILES for [(1R,2S)-2-azaniumyl-1,2-bis(2-hydroxyphenyl)ethyl]azanium dichloride is [Cl-].[Cl-].[NH3+][C@H](c1ccccc1O)[C@@H]([NH3+])c1ccccc1O.
What is the InChIKey of [(1R,2S)-2-azaniumyl-1,2-bis(2-hydroxyphenyl)ethyl]azanium dichloride?
The InChIKey is FSQLRMWRYPBIRJ-DUFSSLHGSA-N. The full InChI is InChI=1S/C14H16N2O2.2ClH/c15-13(9-5-1-3-7-11(9)17)14(16)10-6-2-4-8-12(10)18;;/h1-8,13-14,17-18H,15-16H2;2*1H/t13-,14+;;.
What are the key properties of [(1R,2S)-2-azaniumyl-1,2-bis(2-hydroxyphenyl)ethyl]azanium dichloride?
[(1R,2S)-2-azaniumyl-1,2-bis(2-hydroxyphenyl)ethyl]azanium dichloride has a molecular weight of 317.22 g/mol, XLogP of -5.63, 3 rotatable bonds, 4 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,2S)-2-azaniumyl-1,2-bis(2-hydroxyphenyl)ethyl]azanium dichloride is sourced from PubChem (CID 139065315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).