C16H20N2O2 — CID 170875368
2-[1,4-diamino-3-(2-hydroxyphenyl)butan-2-yl]phenol (PubChem CID 170875368) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is 2-[1,4-diamino-3-(2-hydroxyphenyl)butan-2-yl]phenol.
| Compound Name | 2-[1,4-diamino-3-(2-hydroxyphenyl)butan-2-yl]phenol |
|---|---|
| PubChem CID | 170875368 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | 2-[1,4-diamino-3-(2-hydroxyphenyl)butan-2-yl]phenol |
| SMILES | NCC(c1ccccc1O)C(CN)c1ccccc1O |
| InChI | InChI=1S/C16H20N2O2/c17-9-13(11-5-1-3-7-15(11)19)14(10-18)12-6-2-4-8-16(12)20/h1-8,13-14,19-20H,9-10,17-18H2 |
| InChIKey | UWLILGBREWRBCL-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |