C26H22O4 — CID 67705842
2-[2-(2-hydroxyphenyl)-1,2-bis(4-hydroxyphenyl)ethyl]phenol (PubChem CID 67705842) has the molecular formula C26H22O4 and a molecular weight of 398.46 g/mol. Its IUPAC name is 2-[2-(2-hydroxyphenyl)-1,2-bis(4-hydroxyphenyl)ethyl]phenol.
| Compound Name | 2-[2-(2-hydroxyphenyl)-1,2-bis(4-hydroxyphenyl)ethyl]phenol |
|---|---|
| PubChem CID | 67705842 |
| Molecular Formula | C26H22O4 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | 2-[2-(2-hydroxyphenyl)-1,2-bis(4-hydroxyphenyl)ethyl]phenol |
| SMILES | Oc1ccc(C(c2ccccc2O)C(c2ccc(O)cc2)c2ccccc2O)cc1 |
| InChI | InChI=1S/C26H22O4/c27-19-13-9-17(10-14-19)25(21-5-1-3-7-23(21)29)26(18-11-15-20(28)16-12-18)22-6-2-4-8-24(22)30/h1-16,25-30H |
| InChIKey | ZQWCJCDGDHBNMD-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |