C14H12Cl2O2 — CID 70581591
2-[2,2-dichloro-1-(2-hydroxyphenyl)ethyl]phenol (PubChem CID 70581591) has the molecular formula C14H12Cl2O2 and a molecular weight of 283.15 g/mol. Its IUPAC name is 2-[2,2-dichloro-1-(2-hydroxyphenyl)ethyl]phenol.
| Compound Name | 2-[2,2-dichloro-1-(2-hydroxyphenyl)ethyl]phenol |
|---|---|
| PubChem CID | 70581591 |
| Molecular Formula | C14H12Cl2O2 |
| Molecular Weight | 283.15 g/mol |
| Exact Mass | 282.02 |
| IUPAC Name | 2-[2,2-dichloro-1-(2-hydroxyphenyl)ethyl]phenol |
| SMILES | Oc1ccccc1C(c1ccccc1O)C(Cl)Cl |
| InChI | InChI=1S/C14H12Cl2O2/c15-14(16)13(9-5-1-3-7-11(9)17)10-6-2-4-8-12(10)18/h1-8,13-14,17-18H |
| InChIKey | NHUSVPRSBDXADF-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.15 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|