C27H32O3 — CID 154084421
4-[1,1-bis(4-hydroxy-2,3-dimethylphenyl)propyl]-2,3-dimethylphenol (PubChem CID 154084421) has the molecular formula C27H32O3 and a molecular weight of 404.55 g/mol. Its IUPAC name is 4-[1,1-bis(4-hydroxy-2,3-dimethylphenyl)propyl]-2,3-dimethylphenol.
| Compound Name | 4-[1,1-bis(4-hydroxy-2,3-dimethylphenyl)propyl]-2,3-dimethylphenol |
|---|---|
| PubChem CID | 154084421 |
| Molecular Formula | C27H32O3 |
| Molecular Weight | 404.55 g/mol |
| Exact Mass | 404.24 |
| IUPAC Name | 4-[1,1-bis(4-hydroxy-2,3-dimethylphenyl)propyl]-2,3-dimethylphenol |
| SMILES | CCC(c1ccc(O)c(C)c1C)(c1ccc(O)c(C)c1C)c1ccc(O)c(C)c1C |
| InChI | InChI=1S/C27H32O3/c1-8-27(21-9-12-24(28)18(5)15(21)2,22-10-13-25(29)19(6)16(22)3)23-11-14-26(30)20(7)17(23)4/h9-14,28-30H,8H2,1-7H3 |
| InChIKey | NJXIRJUVKLQFQY-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.55 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|