C17H20O6 — CID 22448286
4-[3-(2,3,4-trihydroxyphenyl)pentan-3-yl]benzene-1,2,3-triol (PubChem CID 22448286) has the molecular formula C17H20O6 and a molecular weight of 320.34 g/mol. Its IUPAC name is 4-[3-(2,3,4-trihydroxyphenyl)pentan-3-yl]benzene-1,2,3-triol.
| Compound Name | 4-[3-(2,3,4-trihydroxyphenyl)pentan-3-yl]benzene-1,2,3-triol |
|---|---|
| PubChem CID | 22448286 |
| Molecular Formula | C17H20O6 |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 4-[3-(2,3,4-trihydroxyphenyl)pentan-3-yl]benzene-1,2,3-triol |
| SMILES | CCC(CC)(c1ccc(O)c(O)c1O)c1ccc(O)c(O)c1O |
| InChI | InChI=1S/C17H20O6/c1-3-17(4-2,9-5-7-11(18)15(22)13(9)20)10-6-8-12(19)16(23)14(10)21/h5-8,18-23H,3-4H2,1-2H3 |
| InChIKey | QRDYVINUNHGUNU-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|