C24H26O9 — CID 20692399
4,6-bis[2-(2,3,4-trihydroxyphenyl)propan-2-yl]benzene-1,2,3-triol (PubChem CID 20692399) has the molecular formula C24H26O9 and a molecular weight of 458.46 g/mol. Its IUPAC name is 4,6-bis[2-(2,3,4-trihydroxyphenyl)propan-2-yl]benzene-1,2,3-triol.
| Compound Name | 4,6-bis[2-(2,3,4-trihydroxyphenyl)propan-2-yl]benzene-1,2,3-triol |
|---|---|
| PubChem CID | 20692399 |
| Molecular Formula | C24H26O9 |
| Molecular Weight | 458.46 g/mol |
| Exact Mass | 458.16 |
| IUPAC Name | 4,6-bis[2-(2,3,4-trihydroxyphenyl)propan-2-yl]benzene-1,2,3-triol |
| SMILES | CC(C)(c1ccc(O)c(O)c1O)c1cc(C(C)(C)c2ccc(O)c(O)c2O)c(O)c(O)c1O |
| InChI | InChI=1S/C24H26O9/c1-23(2,10-5-7-14(25)20(31)16(10)27)12-9-13(19(30)22(33)18(12)29)24(3,4)11-6-8-15(26)21(32)17(11)28/h5-9,25-33H,1-4H3 |
| InChIKey | NMQJBMBQCMMVGH-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 182.07 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.46 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|