C16H18O5 — CID 20692397
4-[2-(2,3-dihydroxy-4-methylphenyl)propan-2-yl]benzene-1,2,3-triol (PubChem CID 20692397) has the molecular formula C16H18O5 and a molecular weight of 290.31 g/mol. Its IUPAC name is 4-[2-(2,3-dihydroxy-4-methylphenyl)propan-2-yl]benzene-1,2,3-triol.
| Compound Name | 4-[2-(2,3-dihydroxy-4-methylphenyl)propan-2-yl]benzene-1,2,3-triol |
|---|---|
| PubChem CID | 20692397 |
| Molecular Formula | C16H18O5 |
| Molecular Weight | 290.31 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | 4-[2-(2,3-dihydroxy-4-methylphenyl)propan-2-yl]benzene-1,2,3-triol |
| SMILES | Cc1ccc(C(C)(C)c2ccc(O)c(O)c2O)c(O)c1O |
| InChI | InChI=1S/C16H18O5/c1-8-4-5-9(13(19)12(8)18)16(2,3)10-6-7-11(17)15(21)14(10)20/h4-7,17-21H,1-3H3 |
| InChIKey | OYSFNZXWTQCLTJ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.31 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|