About 3-amino-2-methylphenol;hydrate
3-amino-2-methylphenol;hydrate (PubChem CID 175262808) has the molecular formula C7H11NO2
and a molecular weight of 141.17 g/mol. Its IUPAC name is 3-amino-2-methylphenol;hydrate.
Molecular Properties
| Compound Name | 3-amino-2-methylphenol;hydrate |
| PubChem CID | 175262808 |
| Molecular Formula | C7H11NO2 |
| Molecular Weight | 141.17 g/mol |
| Exact Mass | 141.08 |
| IUPAC Name | 3-amino-2-methylphenol;hydrate |
| SMILES | Cc1c(N)cccc1O.O |
| InChI | InChI=1S/C7H9NO.H2O/c1-5-6(8)3-2-4-7(5)9;/h2-4,9H,8H2,1H3;1H2 |
| InChIKey | UCUGUCJHJMRDJY-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.17 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-2-methylphenol;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-2-methylphenol;hydrate?
The IUPAC name of 3-amino-2-methylphenol;hydrate (CID 175262808) is 3-amino-2-methylphenol;hydrate.
What is the SMILES notation for 3-amino-2-methylphenol;hydrate?
The canonical SMILES for 3-amino-2-methylphenol;hydrate is Cc1c(N)cccc1O.O.
What is the InChIKey of 3-amino-2-methylphenol;hydrate?
The InChIKey is UCUGUCJHJMRDJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO.H2O/c1-5-6(8)3-2-4-7(5)9;/h2-4,9H,8H2,1H3;1H2.
What are the key properties of 3-amino-2-methylphenol;hydrate?
3-amino-2-methylphenol;hydrate has a molecular weight of 141.17 g/mol, XLogP of 0.46, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-2-methylphenol;hydrate is sourced from PubChem (CID 175262808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).