About 2,5-diaminophenol;2-methylbenzene-1,3-diamine
2,5-diaminophenol;2-methylbenzene-1,3-diamine (PubChem CID 161250673) has the molecular formula C13H18N4O
and a molecular weight of 246.31 g/mol. Its IUPAC name is 2,5-diaminophenol;2-methylbenzene-1,3-diamine.
Molecular Properties
| Compound Name | 2,5-diaminophenol;2-methylbenzene-1,3-diamine |
| PubChem CID | 161250673 |
| Molecular Formula | C13H18N4O |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | 2,5-diaminophenol;2-methylbenzene-1,3-diamine |
| SMILES | Cc1c(N)cccc1N.Nc1ccc(N)c(O)c1 |
| InChI | InChI=1S/C7H10N2.C6H8N2O/c1-5-6(8)3-2-4-7(5)9;7-4-1-2-5(8)6(9)3-4/h2-4H,8-9H2,1H3;1-3,9H,7-8H2 |
| InChIKey | VBFOCYYYWVQLMT-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 124.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 2,5-diaminophenol;2-methylbenzene-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-diaminophenol;2-methylbenzene-1,3-diamine?
The IUPAC name of 2,5-diaminophenol;2-methylbenzene-1,3-diamine (CID 161250673) is 2,5-diaminophenol;2-methylbenzene-1,3-diamine.
What is the SMILES notation for 2,5-diaminophenol;2-methylbenzene-1,3-diamine?
The canonical SMILES for 2,5-diaminophenol;2-methylbenzene-1,3-diamine is Cc1c(N)cccc1N.Nc1ccc(N)c(O)c1.
What is the InChIKey of 2,5-diaminophenol;2-methylbenzene-1,3-diamine?
The InChIKey is VBFOCYYYWVQLMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2.C6H8N2O/c1-5-6(8)3-2-4-7(5)9;7-4-1-2-5(8)6(9)3-4/h2-4H,8-9H2,1H3;1-3,9H,7-8H2.
What are the key properties of 2,5-diaminophenol;2-methylbenzene-1,3-diamine?
2,5-diaminophenol;2-methylbenzene-1,3-diamine has a molecular weight of 246.31 g/mol, XLogP of 1.72, 0 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-diaminophenol;2-methylbenzene-1,3-diamine is sourced from PubChem (CID 161250673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).