C12H13N3O — CID 22173919
3-amino-2-(2,5-diaminophenyl)phenol (PubChem CID 22173919) has the molecular formula C12H13N3O and a molecular weight of 215.26 g/mol. Its IUPAC name is 3-amino-2-(2,5-diaminophenyl)phenol.
| Compound Name | 3-amino-2-(2,5-diaminophenyl)phenol |
|---|---|
| PubChem CID | 22173919 |
| Molecular Formula | C12H13N3O |
| Molecular Weight | 215.26 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | 3-amino-2-(2,5-diaminophenyl)phenol |
| SMILES | Nc1ccc(N)c(-c2c(N)cccc2O)c1 |
| InChI | InChI=1S/C12H13N3O/c13-7-4-5-9(14)8(6-7)12-10(15)2-1-3-11(12)16/h1-6,16H,13-15H2 |
| InChIKey | RXHIOZWHNSSAIF-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 98.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.26 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|